cas: 1038240-94-6 — see every product listed under this CAS number, including other names
1-(2-Fluorophenyl)-1h-1,2,3-triazole-4-carboxylic acid, 95%, 95% (CAS 1038240-94-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BO0V-100mg |
| cas | 1038240-94-6 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(2-fluorophenyl)triazole-4-carboxylic acid (CAS 1038240-94-6) is a chemical compound with the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. IUPAC name: 1-(2-fluorophenyl)triazole-4-carboxylic acid. InChIKey: VKSWBIDDMLYYAU-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O2 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 1-(2-fluorophenyl)triazole-4-carboxylic acid |
| InChIKey | VKSWBIDDMLYYAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=C(N=N2)C(=O)O)F |
Computed by PubChem (NCBI)