CAS 1038240-94-6 appears in our catalog under these names: 1-(2-Fluorophenyl)-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(2-Fluorophenyl)-1h-1,2,3-triazole-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg.
1-(2-fluorophenyl)triazole-4-carboxylic acid (CAS 1038240-94-6) is a chemical compound with the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. IUPAC name: 1-(2-fluorophenyl)triazole-4-carboxylic acid. InChIKey: VKSWBIDDMLYYAU-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O2 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 1-(2-fluorophenyl)triazole-4-carboxylic acid |
| InChIKey | VKSWBIDDMLYYAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=C(N=N2)C(=O)O)F |
Computed by PubChem (NCBI)