CAS 214541-35-2 appears in our catalog under these names: 1-(4-Fluorophenyl)-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(4-Fluorophenyl)-1H-1,2,3-triazole-4-carboxylic acid, 1-(4-fluorophenyl)-1H-1,2,3-triazole-4-carboxylic Acid, 98%, 98%, 1-(4-fluorophenyl)-1H-1,2,3-triazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 0,25g, 0,1g, 0,5g, 2g, 100mg.
1-(4-fluorophenyl)triazole-4-carboxylic acid (CAS 214541-35-2) is a chemical compound with the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. IUPAC name: 1-(4-fluorophenyl)triazole-4-carboxylic acid. InChIKey: CCCIZOONJWEKRR-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O2 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 1-(4-fluorophenyl)triazole-4-carboxylic acid |
| InChIKey | CCCIZOONJWEKRR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(N=N2)C(=O)O)F |
Computed by PubChem (NCBI)