CAS 1292369-51-7 appears in our catalog under these names: 1-(3-Fluorophenyl)-1h-1,2,4-triazole-3-carboxylic acid, 95%, 1-(3-Fluorophenyl)-1H-1,2,4-triazole-3-carboxylic acid, 95+%, 1–(3–Fluorophenyl)–1H–1,2,4–triazole–3–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
1-(3-fluorophenyl)-1,2,4-triazole-3-carboxylic acid (CAS 1292369-51-7) is a chemical compound with the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. IUPAC name: 1-(3-fluorophenyl)-1,2,4-triazole-3-carboxylic acid. InChIKey: ZZRGWKUNFQGVSY-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O2 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-1,2,4-triazole-3-carboxylic acid |
| InChIKey | ZZRGWKUNFQGVSY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)N2C=NC(=N2)C(=O)O |
Computed by PubChem (NCBI)