cas: 147636-34-8 — see every product listed under this CAS number, including other names
1-(2-THIENYLCARBONYL)PIPERIDINE-4-CARBOXYLIC ACID, 95%, 95% (CAS 147636-34-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ACVH-100mg |
| cas | 147636-34-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 429.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(thiophene-2-carbonyl)piperidine-4-carboxylic acid (CAS 147636-34-8) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: 1-(thiophene-2-carbonyl)piperidine-4-carboxylic acid. InChIKey: NSWSBWQLPNNZQJ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | 1-(thiophene-2-carbonyl)piperidine-4-carboxylic acid |
| InChIKey | NSWSBWQLPNNZQJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)