CAS 13130-43-3 is the registry number for 2-(Acetylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (CAS 13130-43-3) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: 2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid. InChIKey: YQJPHNLITLRBAJ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | 2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
| InChIKey | YQJPHNLITLRBAJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C2=C(S1)CCCC2)C(=O)O |
Computed by PubChem (NCBI)