Products 13130-43-3

CAS 13130-43-3 is the registry number for 2-(Acetylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (CAS 13130-43-3) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: 2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid. InChIKey: YQJPHNLITLRBAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO3S
Molecular weight239.29 g/mol
IUPAC name2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid
InChIKeyYQJPHNLITLRBAJ-UHFFFAOYSA-N
SMILESCC(=O)NC1=C(C2=C(S1)CCCC2)C(=O)O

Computed by PubChem (NCBI)