cas: 99011-02-6 — see every product listed under this CAS number, including other names
1-(2-methylpropyl)-1H-imidazo[4,5-c]quinolin-4-amine, 99%, 99% (CAS 99011-02-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11461O-100mg |
| cas | 99011-02-6 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 251.60 Pln | |
| Chemat | 10g | 438.80 Pln | |
| Chemat | 25g | 827.60 Pln | |
| Chemat | 100g | 3098.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Imiquimod is an imidazoquinoline fused [4,5-c] carrying isobutyl and amino substituents at N-1 and C-4 respectively. A prescription medication, it acts as an immune response modifier and is used to treat genital warts, superficial basal cell carcinoma, and actinic keratosis. It has a role as an antineoplastic agent and an interferon inducer.
Source: ChEBI
| Molecular formula | C14H16N4 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine |
| InChIKey | DOUYETYNHWVLEO-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
Computed by PubChem (NCBI)