Products 2712126-48-0
CAS 2712126-48-0 appears in our catalog under these names: Imiquimod–d9, Imiquimod-d9. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 500μg, 500 μg.
1-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]imidazo[4,5-c]quinolin-4-amine (CAS 2712126-48-0) is a chemical compound with the molecular formula C14H16N4 and a molecular weight of 249.36 g/mol. IUPAC name: 1-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]imidazo[4,5-c]quinolin-4-amine. InChIKey: DOUYETYNHWVLEO-UEZIPFSLSA-N.
| Molecular formula | C14H16N4 |
|---|---|
| Molecular weight | 249.36 g/mol |
| IUPAC name | 1-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]imidazo[4,5-c]quinolin-4-amine |
| InChIKey | DOUYETYNHWVLEO-UEZIPFSLSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])N1C=NC2=C1C3=CC=CC=C3N=C2N |
Computed by PubChem (NCBI)