CAS 90944-01-7 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)butan-1-amine hydrochloride, 97%, 97%, 1-(3,4-Dichlorophenyl)butan-1-amine hydrochloride, 97%, 1-(3,4-Dichlorophenyl)butan-1-amine hydrochloride, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 500mg, 2.5g.
1-(3,4-dichlorophenyl)butan-1-amine;hydrochloride (CAS 90944-01-7) is a chemical compound with the molecular formula C10H14Cl3N and a molecular weight of 254.6 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)butan-1-amine;hydrochloride. InChIKey: GVPJQUXPUXYTFC-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl3N |
|---|---|
| Molecular weight | 254.6 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)butan-1-amine;hydrochloride |
| InChIKey | GVPJQUXPUXYTFC-UHFFFAOYSA-N |
| SMILES | CCCC(C1=CC(=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)