CAS 1425093-27-1 is the registry number for (R)-4-(3,4-Dichlorophenyl)butan-2-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-4-(3,4-dichlorophenyl)butan-2-amine;hydrochloride (CAS 1425093-27-1) is a chemical compound with the molecular formula C10H14Cl3N and a molecular weight of 254.6 g/mol. IUPAC name: (2R)-4-(3,4-dichlorophenyl)butan-2-amine;hydrochloride. InChIKey: ITWWHFUIJCZXAF-OGFXRTJISA-N.
| Molecular formula | C10H14Cl3N |
|---|---|
| Molecular weight | 254.6 g/mol |
| IUPAC name | (2R)-4-(3,4-dichlorophenyl)butan-2-amine;hydrochloride |
| InChIKey | ITWWHFUIJCZXAF-OGFXRTJISA-N |
| SMILES | C[C@H](CCC1=CC(=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)