CAS 959140-07-9 appears in our catalog under these names: 2-(2,6-Dichlorophenyl)-2-methylpropan-1-amine hydrochloride, 95%, 2-(2,6-Dichlorophenyl)-2-methylpropan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
2-(2,6-dichlorophenyl)-2-methylpropan-1-amine;hydrochloride (CAS 959140-07-9) is a chemical compound with the molecular formula C10H14Cl3N and a molecular weight of 254.6 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-2-methylpropan-1-amine;hydrochloride. InChIKey: SVXZEBGUPONAOZ-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl3N |
|---|---|
| Molecular weight | 254.6 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-2-methylpropan-1-amine;hydrochloride |
| InChIKey | SVXZEBGUPONAOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)C1=C(C=CC=C1Cl)Cl.Cl |
Computed by PubChem (NCBI)