CAS 151947-48-7 is the registry number for 2-(3,4-Dichlorophenyl)-2-methylpropylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3,4-dichlorophenyl)-2-methylpropan-1-amine;hydrochloride (CAS 151947-48-7) is a chemical compound with the molecular formula C10H14Cl3N and a molecular weight of 254.6 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-2-methylpropan-1-amine;hydrochloride. InChIKey: DGUOZIQFXKPLDJ-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl3N |
|---|---|
| Molecular weight | 254.6 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-2-methylpropan-1-amine;hydrochloride |
| InChIKey | DGUOZIQFXKPLDJ-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)C1=CC(=C(C=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)