cas: 19578-92-8 — see every product listed under this CAS number, including other names
1-(3,4-Dimethoxyphenyl)-2-propanol, 95% (CAS 19578-92-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F375139-100MG |
| cas | 19578-92-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 91.65 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 981.96 Pln | |
| Fluorochem | 10g | 1908.72 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(3,4-dimethoxyphenyl)propan-2-ol (CAS 19578-92-8) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)propan-2-ol. InChIKey: KWJDGWGMDAQESJ-UHFFFAOYSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)propan-2-ol |
| InChIKey | KWJDGWGMDAQESJ-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)OC)OC)O |
Computed by PubChem (NCBI)