cas: 19578-92-8 — see every product listed under this CAS number, including other names
1-(3,4-Dimethoxyphenyl)propan-2-ol, 98%, 98% (CAS 19578-92-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11B17O-100mg |
| cas | 19578-92-8 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 453.20 Pln | |
| Chemat | 5g | 1269.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(3,4-dimethoxyphenyl)propan-2-ol (CAS 19578-92-8) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)propan-2-ol. InChIKey: KWJDGWGMDAQESJ-UHFFFAOYSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)propan-2-ol |
| InChIKey | KWJDGWGMDAQESJ-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)OC)OC)O |
Computed by PubChem (NCBI)