cas: 141454-65-1 — see every product listed under this CAS number, including other names
1-(3,5-Dichloropyridin-2-yl)ethanone 95% (CAS 141454-65-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A895542-250mg |
| cas | 141454-65-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1360.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A895542 |
1-(3,5-dichloro-2-pyridinyl)ethanone (CAS 141454-65-1) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: 1-(3,5-dichloro-2-pyridinyl)ethanone. InChIKey: FDBXTZVAEKVARE-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | 1-(3,5-dichloro-2-pyridinyl)ethanone |
| InChIKey | FDBXTZVAEKVARE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=N1)Cl)Cl |
Computed by PubChem (NCBI)