CAS 4414-54-4 appears in our catalog under these names: 2,3-Dichlorobenzaldoxime, 97%, 2,3-Dichlorobenzaldehyde oxime. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 25g, 1g, 50g.
(NE)-N-[(2,3-dichlorophenyl)methylidene]hydroxylamine (CAS 4414-54-4) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: (NE)-N-[(2,3-dichlorophenyl)methylidene]hydroxylamine. InChIKey: UDEADLUKAYYZNF-ONNFQVAWSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | (NE)-N-[(2,3-dichlorophenyl)methylidene]hydroxylamine |
| InChIKey | UDEADLUKAYYZNF-ONNFQVAWSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)/C=N/O |
Computed by PubChem (NCBI)