cas: 1262681-30-0 — see every product listed under this CAS number, including other names
1-(3,6,9,12-Tetraoxapentadec-14-yn-1-yl)-1H-pyrrole-2,5-dione, 98%, 98% (CAS 1262681-30-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 5mg, 10mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JOTQ-5g |
| cas | 1262681-30-0 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 11406.80 Pln | |
| Chemat | 5mg | 357.20 Pln | |
| Chemat | 10mg | 506.00 Pln | |
| Chemat | 100mg | 592.40 Pln | |
| Chemat | 250mg | 1067.60 Pln | |
| Chemat | 1g | 2776.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione (CAS 1262681-30-0) is a chemical compound with the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. IUPAC name: 1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione. InChIKey: HNIXCHONNFMINC-UHFFFAOYSA-N.
| Molecular formula | C15H21NO6 |
|---|---|
| Molecular weight | 311.33 g/mol |
| IUPAC name | 1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
| InChIKey | HNIXCHONNFMINC-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)