cas: 1262681-30-0 — see every product listed under this CAS number, including other names
Mal-PEG4-propargyl, 98% (CAS 1262681-30-0) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 10mg, 50mg, 5mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1255903-25mg |
| cas | 1262681-30-0 |
| size | 25mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25mg | 877.24 Pln | |
| AmBeed | 10mg | 473.62 Pln | |
| AmBeed | 50mg | 1358.98 Pln | |
| AmBeed | 5mg | 323.89 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione (CAS 1262681-30-0) is a chemical compound with the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. IUPAC name: 1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione. InChIKey: HNIXCHONNFMINC-UHFFFAOYSA-N.
| Molecular formula | C15H21NO6 |
|---|---|
| Molecular weight | 311.33 g/mol |
| IUPAC name | 1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
| InChIKey | HNIXCHONNFMINC-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)