cas: 1262681-30-0 — see every product listed under this CAS number, including other names
Alkyne-PEG4-Maleimide, 95% (CAS 1262681-30-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Lumiprobe.
| brand | Lumiprobe |
|---|---|
| catalog number | LP-2002-x-100mg |
| cas | 1262681-30-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Lumiprobe | 100mg | 813.16 Pln | |
| Lumiprobe | 1g | 2773.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 2 weeks |
1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione (CAS 1262681-30-0) is a chemical compound with the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. IUPAC name: 1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione. InChIKey: HNIXCHONNFMINC-UHFFFAOYSA-N.
| Molecular formula | C15H21NO6 |
|---|---|
| Molecular weight | 311.33 g/mol |
| IUPAC name | 1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
| InChIKey | HNIXCHONNFMINC-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)