cas: 1024869-25-7 — see every product listed under this CAS number, including other names
1-(3-(4-Aminophenyl)propanoyl)azetidin-2-one 97% (CAS 1024869-25-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A558820-5g |
| cas | 1024869-25-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 3591.06 Pln | |
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 948.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A558820 |
1-[3-(4-aminophenyl)propanoyl]azetidin-2-one (CAS 1024869-25-7) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 1-[3-(4-aminophenyl)propanoyl]azetidin-2-one. InChIKey: CCVFEHRZMGTCMR-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 1-[3-(4-aminophenyl)propanoyl]azetidin-2-one |
| InChIKey | CCVFEHRZMGTCMR-UHFFFAOYSA-N |
| SMILES | C1CN(C1=O)C(=O)CCC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)