CAS 18593-45-8 appears in our catalog under these names: 2,5,6-trimethyl-3H-thieno[2,3-d]pyrimidin-4-one, 95%, 2,5,6-Trimethylthieno(2,3-d)pyrimidin-4(3h)-one, 98%, 2,5,6-Trimethyl-3H,4H-thieno(2,3-d)pyrimidin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 2,5g.
2,5,6-trimethyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 18593-45-8) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 2,5,6-trimethyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: ONHXPYXOJCRCBR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 2,5,6-trimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | ONHXPYXOJCRCBR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)NC(=N2)C)C |
Computed by PubChem (NCBI)