CAS 878465-91-9 appears in our catalog under these names: [5-(2-Methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine, 95%, (5-(2-Methyl-1,3-thiazol-4-yl)furan-2-yl)methanamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
[5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine (CAS 878465-91-9) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine. InChIKey: KYUQAHJPQLLHQR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | [5-(2-methyl-1,3-thiazol-4-yl)furan-2-yl]methanamine |
| InChIKey | KYUQAHJPQLLHQR-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(O2)CN |
Computed by PubChem (NCBI)