CAS 88686-30-0 appears in our catalog under these names: 4-Methoxy-7-methyl-1,3-benzothiazol-2-amine, 98%, 4-Methoxy-7-methyl-1,3-benzothiazol-2-amine, 95%, 95%, 4-METHOXY-7-METHYLBENZO[D]THIAZOL-2-AMINE, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg, 500mg, 2.5g.
4-methoxy-7-methyl-1,3-benzothiazol-2-amine (CAS 88686-30-0) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 4-methoxy-7-methyl-1,3-benzothiazol-2-amine. InChIKey: BPFSLCTUFLBWNK-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 4-methoxy-7-methyl-1,3-benzothiazol-2-amine |
| InChIKey | BPFSLCTUFLBWNK-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)OC)N=C(S2)N |
Computed by PubChem (NCBI)