1-(3-Aminophenyl)imidazolidin-2-one, 95%
cas: 938459-14-4 — see every product listed under this CAS number, including other names
1-(3-Aminophenyl)imidazolidin-2-one, 95% (CAS 938459-14-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | JH-0123-5g |
| cas | 938459-14-4 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2117.00 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 403.22 Pln | |
| BLDpharm | 1g | 730.88 Pln | |
| BLDpharm | 5g | 2080.40 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 654.80 Pln | |
| Chemat | 5g | 1869.20 Pln | |
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 586.27 Pln | |
| Fluorochem | 1g | 1211.05 Pln | |
| Fluorochem | 5g | 3449.84 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-(3-aminophenyl)imidazolidin-2-one (CAS 938459-14-4) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 1-(3-aminophenyl)imidazolidin-2-one. InChIKey: BPKSYMQSNOQBGA-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1-(3-aminophenyl)imidazolidin-2-one |
| InChIKey | BPKSYMQSNOQBGA-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)N1)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)