CAS 172648-58-7 appears in our catalog under these names: 3H-Imidazo[4,5-b]pyridine-2-methanol, 5,7-dimethyl-, 95%, (5,7-Dimethyl-3H-imidazo(4,5-b)pyridin-2-yl)methanol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(5,7-dimethyl-1H-imidazo[4,5-b]pyridin-2-yl)methanol (CAS 172648-58-7) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: (5,7-dimethyl-1H-imidazo[4,5-b]pyridin-2-yl)methanol. InChIKey: KKQIUNASZAWCJV-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (5,7-dimethyl-1H-imidazo[4,5-b]pyridin-2-yl)methanol |
| InChIKey | KKQIUNASZAWCJV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1NC(=N2)CO)C |
Computed by PubChem (NCBI)