Products 1019534-31-6
CAS 1019534-31-6 appears in our catalog under these names: 5-Amino-2,3-dihydro-1h-indole-1-carboxamide, 95%, 5-Amino-2,3-dihydro-1H-indole-1-carboxamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
5-amino-2,3-dihydroindole-1-carboxamide (CAS 1019534-31-6) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 5-amino-2,3-dihydroindole-1-carboxamide. InChIKey: DTPBNLLSZZKGPM-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 5-amino-2,3-dihydroindole-1-carboxamide |
| InChIKey | DTPBNLLSZZKGPM-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=C(C=C2)N)C(=O)N |
Computed by PubChem (NCBI)