cas: 871269-12-4 — see every product listed under this CAS number, including other names
1-(3-Bromophenylsulfonyl)Piperidine (CAS 871269-12-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115KPM-1g |
| cas | 871269-12-4 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 25g | 602.00 Pln | |
| Chemat | 100g | 1566.80 Pln |
| delivery time | 3 weeks |
|---|
1-(3-bromophenyl)sulfonylpiperidine (CAS 871269-12-4) is a chemical compound with the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. IUPAC name: 1-(3-bromophenyl)sulfonylpiperidine. InChIKey: LUWHLKYMEKGKAT-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2S |
|---|---|
| Molecular weight | 304.21 g/mol |
| IUPAC name | 1-(3-bromophenyl)sulfonylpiperidine |
| InChIKey | LUWHLKYMEKGKAT-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)