CAS 1044924-09-5 appears in our catalog under these names: 4-(4-Bromo-benzyl)-thiomorpholine 1,1-dioxide, 95%, 4-(4-Bromo-benzyl)-thiomorpholine 1,1-dioxide, 4-(4-Bromobenzyl)thiomorpholine 1,1-dioxide, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-[(4-bromophenyl)methyl]-1,4-thiazinane 1,1-dioxide (CAS 1044924-09-5) is a chemical compound with the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. IUPAC name: 4-[(4-bromophenyl)methyl]-1,4-thiazinane 1,1-dioxide. InChIKey: KSSKLCBHWXGCIQ-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2S |
|---|---|
| Molecular weight | 304.21 g/mol |
| IUPAC name | 4-[(4-bromophenyl)methyl]-1,4-thiazinane 1,1-dioxide |
| InChIKey | KSSKLCBHWXGCIQ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)