CAS 285995-01-9 appears in our catalog under these names: 4-(4-bromobenzenesulfonyl)piperidine, 95%, 4-(4-Bromobenzenesulfonyl)piperidine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.
4-(4-bromophenyl)sulfonylpiperidine (CAS 285995-01-9) is a chemical compound with the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. IUPAC name: 4-(4-bromophenyl)sulfonylpiperidine. InChIKey: JLFNPSVUHQMQHA-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2S |
|---|---|
| Molecular weight | 304.21 g/mol |
| IUPAC name | 4-(4-bromophenyl)sulfonylpiperidine |
| InChIKey | JLFNPSVUHQMQHA-UHFFFAOYSA-N |
| SMILES | C1CNCCC1S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)