CAS 1056421-99-8 is the registry number for 5-Bromo-1-(propane-2-sulfonyl)-2,3-dihydro-1h-indole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-1-propan-2-ylsulfonyl-2,3-dihydroindole (CAS 1056421-99-8) is a chemical compound with the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. IUPAC name: 5-bromo-1-propan-2-ylsulfonyl-2,3-dihydroindole. InChIKey: ANRFIAKHKHOAJQ-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2S |
|---|---|
| Molecular weight | 304.21 g/mol |
| IUPAC name | 5-bromo-1-propan-2-ylsulfonyl-2,3-dihydroindole |
| InChIKey | ANRFIAKHKHOAJQ-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)N1CCC2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)