CAS 53712-77-9 is the registry number for 3-(4-Nitrophenyl)propyl bromide. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
1-(3-bromopropyl)-4-nitrobenzene (CAS 53712-77-9) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 1-(3-bromopropyl)-4-nitrobenzene. InChIKey: QQUGTTJYNYXZSW-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 1-(3-bromopropyl)-4-nitrobenzene |
| InChIKey | QQUGTTJYNYXZSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCCBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)