CAS 42718-15-0 is the registry number for Methyl 2-amino-2-(4-bromophenyl)acetate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 10g, 25g, 1g.
Methyl 2-amino-2-(4-bromophenyl)acetate (CAS 42718-15-0) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: methyl 2-amino-2-(4-bromophenyl)acetate. InChIKey: YERRTOUSFSZICJ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | methyl 2-amino-2-(4-bromophenyl)acetate |
| InChIKey | YERRTOUSFSZICJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=C(C=C1)Br)N |
Computed by PubChem (NCBI)