cas: 1092459-54-5 — see every product listed under this CAS number, including other names
1-(3-Bromopyridin-4-yl)-2,2,2-trifluoroethanol, ≥95%, ≥95% (CAS 1092459-54-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KYEF-1g |
| cas | 1092459-54-5 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2469.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-(3-bromo-4-pyridinyl)-2,2,2-trifluoroethanol (CAS 1092459-54-5) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 1-(3-bromo-4-pyridinyl)-2,2,2-trifluoroethanol. InChIKey: LKXLQKSPUWXKFW-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 1-(3-bromo-4-pyridinyl)-2,2,2-trifluoroethanol |
| InChIKey | LKXLQKSPUWXKFW-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(C(F)(F)F)O)Br |
Computed by PubChem (NCBI)