CAS 1357095-12-5 is the registry number for 3-Bromo-4-(2,2,2-trifluoroethoxy)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-bromo-4-(2,2,2-trifluoroethoxy)pyridine (CAS 1357095-12-5) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 3-bromo-4-(2,2,2-trifluoroethoxy)pyridine. InChIKey: HAEMAOMMHYTAMI-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 3-bromo-4-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | HAEMAOMMHYTAMI-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1OCC(F)(F)F)Br |
Computed by PubChem (NCBI)