Products 1093880-21-7
CAS 1093880-21-7 appears in our catalog under these names: 1-(6-Bromopyridin-2-yl)-2,2,2-trifluoroethan-1-ol, 95%, 1-(6-Bromopyridin-2-yl)-2,2,2-trifluoroethan-1-ol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethanol (CAS 1093880-21-7) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethanol. InChIKey: VJPDICWIBLOKKQ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethanol |
| InChIKey | VJPDICWIBLOKKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Br)C(C(F)(F)F)O |
Computed by PubChem (NCBI)