Products 760207-89-4
CAS 760207-89-4 is the registry number for 3-Bromo-2-(2,2,2-trifluoroethoxy)pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
3-bromo-2-(2,2,2-trifluoroethoxy)pyridine (CAS 760207-89-4) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 3-bromo-2-(2,2,2-trifluoroethoxy)pyridine. InChIKey: GDEKUOJPEJVREN-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 3-bromo-2-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | GDEKUOJPEJVREN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)