cas: 832739-72-7 — see every product listed under this CAS number, including other names
1-(3-Chloro-benzyl)-1 H -[1,2,4]triazol-3-ylamine, 98% (CAS 832739-72-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F030406-100MG |
| cas | 832739-72-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 581.06 Pln | |
| Fluorochem | 250mg | 924.69 Pln | |
| Fluorochem | 1g | 1794.18 Pln | |
| Fluorochem | 5g | 5620.96 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[(3-chlorophenyl)methyl]-1,2,4-triazol-3-amine (CAS 832739-72-7) is a chemical compound with the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. IUPAC name: 1-[(3-chlorophenyl)methyl]-1,2,4-triazol-3-amine. InChIKey: CNQNEIWBVLGIEA-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4 |
|---|---|
| Molecular weight | 208.65 g/mol |
| IUPAC name | 1-[(3-chlorophenyl)methyl]-1,2,4-triazol-3-amine |
| InChIKey | CNQNEIWBVLGIEA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CN2C=NC(=N2)N |
Computed by PubChem (NCBI)