CAS 886361-79-1 is the registry number for [1-(4-Chlorophenyl)-1h-1,2,3-triazol-4-yl]methanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[1-(4-chlorophenyl)triazol-4-yl]methanamine (CAS 886361-79-1) is a chemical compound with the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. IUPAC name: [1-(4-chlorophenyl)triazol-4-yl]methanamine. InChIKey: BYTINHZLLQJDHE-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4 |
|---|---|
| Molecular weight | 208.65 g/mol |
| IUPAC name | [1-(4-chlorophenyl)triazol-4-yl]methanamine |
| InChIKey | BYTINHZLLQJDHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(N=N2)CN)Cl |
Computed by PubChem (NCBI)