Products 1094292-72-4
CAS 1094292-72-4 appears in our catalog under these names: 6-Chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-b]pyridazine, 95%, 6-Chloro-3-cyclobutyl-(1,2,4)triazolo(4,3-b)pyridazine, 97%, 6-Chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-b]pyridazine, 97%, 97%, 6-Chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-b]pyridazine, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-b]pyridazine (CAS 1094292-72-4) is a chemical compound with the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. IUPAC name: 6-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: GLOLCOQONUEGTN-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4 |
|---|---|
| Molecular weight | 208.65 g/mol |
| IUPAC name | 6-chloro-3-cyclobutyl-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | GLOLCOQONUEGTN-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=NN=C3N2N=C(C=C3)Cl |
Computed by PubChem (NCBI)