1-(3-Methoxy-4-nitrophenyl)piperazine, ≥95%
cas: 121278-37-3 — see every product listed under this CAS number, including other names
1-(3-Methoxy-4-nitrophenyl)piperazine, ≥95% (CAS 121278-37-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch110ZZN-100mg |
| cas | 121278-37-3 |
| size | 100mg |
| availability | 200g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 1029.20 Pln | |
| Chemat | 5g | 2061.20 Pln | |
| Chemat | 25g | 6016.40 Pln | |
| Chemat | 100g | 13158.80 Pln | |
| Fluorochem | 1g | 1898.31 Pln | |
| Fluorochem | 100mg | 643.54 Pln | |
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 5g | 3809.09 Pln | |
| Fluorochem | 25g | 10973.24 Pln | |
| Fluorochem | 100g | 24041.55 Pln |
properties
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-(3-methoxy-4-nitrophenyl)piperazine (CAS 121278-37-3) is a chemical compound with the molecular formula C11H15N3O3 and a molecular weight of 237.25 g/mol. IUPAC name: 1-(3-methoxy-4-nitrophenyl)piperazine. InChIKey: HPFKHBWFRKOXLW-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O3 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 1-(3-methoxy-4-nitrophenyl)piperazine |
| InChIKey | HPFKHBWFRKOXLW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCNCC2)[N+](=O)[O-] |
Computed by PubChem (NCBI)