cas: 294210-79-0 — see every product listed under this CAS number, including other names
1-(3-Nitrophenyl)-piperazine hydrochloride (CAS 294210-79-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F019978-1G |
| cas | 294210-79-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 830.98 Pln | |
| Fluorochem | 25g | 2163.84 Pln |
| delivery time | 2-3 weeks |
|---|
1-(3-nitrophenyl)piperazine;hydrochloride (CAS 294210-79-0) is a chemical compound with the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. IUPAC name: 1-(3-nitrophenyl)piperazine;hydrochloride. InChIKey: VFTSNUZGFRTULB-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O2 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 1-(3-nitrophenyl)piperazine;hydrochloride |
| InChIKey | VFTSNUZGFRTULB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=CC=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)