CAS 260252-87-7 appears in our catalog under these names: 1-(4-Nitrophenyl)piperazine hydrochloride, 95%, 1–(4–Nitrophenyl)Piperazine Hydrochloride, 1-(4-Nitrophenyl)Piperazine Hydrochloride, 95%, 95%, 1-(4-NITROPHENYL)PIPERAZINE HCL, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 100g.
1-(4-nitrophenyl)piperazine;hydrochloride (CAS 260252-87-7) is a chemical compound with the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. IUPAC name: 1-(4-nitrophenyl)piperazine;hydrochloride. InChIKey: QRQYCCQVGRORKX-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O2 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 1-(4-nitrophenyl)piperazine;hydrochloride |
| InChIKey | QRQYCCQVGRORKX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)