CAS 6270-12-8 is the registry number for 1-(2-Nitrophenyl)piperazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-(2-nitrophenyl)piperazine;hydrochloride (CAS 6270-12-8) is a chemical compound with the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. IUPAC name: 1-(2-nitrophenyl)piperazine;hydrochloride. InChIKey: ZSXNQTQDJNJPGR-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O2 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 1-(2-nitrophenyl)piperazine;hydrochloride |
| InChIKey | ZSXNQTQDJNJPGR-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=CC=C2[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)