CAS 294210-79-0 appears in our catalog under these names: 1-(3-Nitrophenyl)piperazine hydrochloride, 95%, 1–(3–Nitrophenyl)–Piperazine, 1-(3-Nitrophenyl)piperazine hydrochloride, 99%+(HPLC),RG, 99%+(HPLC),RG, 1-(3-Nitrophenyl)-piperazine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
1-(3-nitrophenyl)piperazine;hydrochloride (CAS 294210-79-0) is a chemical compound with the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. IUPAC name: 1-(3-nitrophenyl)piperazine;hydrochloride. InChIKey: VFTSNUZGFRTULB-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O2 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 1-(3-nitrophenyl)piperazine;hydrochloride |
| InChIKey | VFTSNUZGFRTULB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=CC=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)