cas: 923130-21-6 — see every product listed under this CAS number, including other names
1-(3-bromophenyl)cyclohexane-1-carboxylic acid, 98% (CAS 923130-21-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F512220-100MG |
| cas | 923130-21-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 638.33 Pln | |
| Fluorochem | 500mg | 1153.78 Pln | |
| Fluorochem | 1g | 1632.78 Pln | |
| Fluorochem | 2.5g | 4006.94 Pln | |
| Fluorochem | 5g | 7948.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(3-bromophenyl)cyclohexane-1-carboxylic acid (CAS 923130-21-6) is a chemical compound with the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. IUPAC name: 1-(3-bromophenyl)cyclohexane-1-carboxylic acid. InChIKey: LADNJYDIETWEEI-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO2 |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 1-(3-bromophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | LADNJYDIETWEEI-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC(=CC=C2)Br)C(=O)O |
Computed by PubChem (NCBI)