CAS 1544740-14-8 is the registry number for 3-[(4-Bromo-3,5-dimethylphenoxy)methyl]cyclobutan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(4-bromo-3,5-dimethylphenoxy)methyl]cyclobutan-1-one (CAS 1544740-14-8) is a chemical compound with the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. IUPAC name: 3-[(4-bromo-3,5-dimethylphenoxy)methyl]cyclobutan-1-one. InChIKey: OHSVAMMHPBKKNI-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO2 |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 3-[(4-bromo-3,5-dimethylphenoxy)methyl]cyclobutan-1-one |
| InChIKey | OHSVAMMHPBKKNI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)OCC2CC(=O)C2 |
Computed by PubChem (NCBI)