Products 923130-21-6
CAS 923130-21-6 appears in our catalog under these names: 1-(3-bromophenyl)cyclohexane-1-carboxylic acid, 95%, 1-(3-bromophenyl)cyclohexane-1-carboxylic acid, 1-(3-Bromophenyl)cyclohexanecarboxylic acid 97%, 1-(3-Bromophenyl)cyclohexanecarboxylic acid, 98%, 98%, 1-(3-bromophenyl)cyclohexane-1-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 500mg, 2.5g.
1-(3-bromophenyl)cyclohexane-1-carboxylic acid (CAS 923130-21-6) is a chemical compound with the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. IUPAC name: 1-(3-bromophenyl)cyclohexane-1-carboxylic acid. InChIKey: LADNJYDIETWEEI-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO2 |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 1-(3-bromophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | LADNJYDIETWEEI-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC(=CC=C2)Br)C(=O)O |
Computed by PubChem (NCBI)