CAS 2091217-78-4 is the registry number for Ethyl 7-bromo-1,2,3,4-tetrahydronaphthalene-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 7-bromo-1,2,3,4-tetrahydronaphthalene-2-carboxylate (CAS 2091217-78-4) is a chemical compound with the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. IUPAC name: ethyl 7-bromo-1,2,3,4-tetrahydronaphthalene-2-carboxylate. InChIKey: QRRKULBWPWESEI-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO2 |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | ethyl 7-bromo-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| InChIKey | QRRKULBWPWESEI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC2=C(C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)