cas: 692737-66-9 — see every product listed under this CAS number, including other names
1-(3-fluorophenyl)cyclopropanamine hydrochloride, 97% (CAS 692737-66-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F064444-250MG |
| cas | 692737-66-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 206.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(3-fluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 692737-66-9) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: 1-(3-fluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: LZAJSOANABVKSY-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | 1-(3-fluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | LZAJSOANABVKSY-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=CC=C2)F)N.Cl |
Computed by PubChem (NCBI)