cas: 2549160-47-4 — see every product listed under this CAS number, including other names
1-(4,4,4-Trifluoro-3-hydroxybutyl)-1H-pyrazole-5-carboxylic acid, 95% (CAS 2549160-47-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F982745-100MG |
| cas | 2549160-47-4 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1445.34 Pln | |
| Fluorochem | 250mg | 2356.48 Pln | |
| Fluorochem | 1g | 5428.31 Pln | |
| Fluorochem | 5g | 15862.14 Pln | |
| Chemat | 100mg | 1125.20 Pln | |
| Chemat | 250mg | 1850.00 Pln | |
| Chemat | 1g | 4278.80 Pln | |
| Chemat | 5g | 12712.40 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2-(4,4,4-trifluoro-3-hydroxybutyl)pyrazole-3-carboxylic acid (CAS 2549160-47-4) is a chemical compound with the molecular formula C8H9F3N2O3 and a molecular weight of 238.16 g/mol. IUPAC name: 2-(4,4,4-trifluoro-3-hydroxybutyl)pyrazole-3-carboxylic acid. InChIKey: VKBZGIMYRNKIKG-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O3 |
|---|---|
| Molecular weight | 238.16 g/mol |
| IUPAC name | 2-(4,4,4-trifluoro-3-hydroxybutyl)pyrazole-3-carboxylic acid |
| InChIKey | VKBZGIMYRNKIKG-UHFFFAOYSA-N |
| SMILES | C1=C(N(N=C1)CCC(C(F)(F)F)O)C(=O)O |
Computed by PubChem (NCBI)